6BrCaQ structure
|
Common Name | 6BrCaQ | ||
|---|---|---|---|---|
| CAS Number | 954416-67-2 | Molecular Weight | 387.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 6BrCaQ6BrCaQ is a potent mitochondrial heat shock protein TRAP1 inhibitor, with antiproliferative activity. 6BrCaQ can be used in the synthesis of 6BrCaQ-TPP conjugates[1]. |
| Name | 6BrCaQ |
|---|
| Description | 6BrCaQ is a potent mitochondrial heat shock protein TRAP1 inhibitor, with antiproliferative activity. 6BrCaQ can be used in the synthesis of 6BrCaQ-TPP conjugates[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H15BrN2O3 |
|---|---|
| Molecular Weight | 387.23 |
| InChIKey | RCKMJRZPGJEVGF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Nc2cc3cc(Br)ccc3n(C)c2=O)cc1 |