methyl 12-oxooctadec-10-ynoate structure
|
Common Name | methyl 12-oxooctadec-10-ynoate | ||
|---|---|---|---|---|
| CAS Number | 95080-06-1 | Molecular Weight | 308.45600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 12-oxooctadec-10-ynoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H32O3 |
|---|---|
| Molecular Weight | 308.45600 |
| Exact Mass | 308.23500 |
| PSA | 43.37000 |
| LogP | 4.82310 |
| InChIKey | JHLGBIOILJKNNK-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)C#CCCCCCCCCC(=O)OC |
|
~%
methyl 12-oxooc... CAS#:95080-06-1 |
| Literature: Frankel, Edwin N.; Garwood, Robert F.; Khambay, Bhupinder P. S.; Moss, Gerard P.; Weedon, Basil C. L. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 10 p. 2233 - 2240 |
| 10-Octadecynoic acid,12-oxo-,methyl ester |