tert-butyl 4-(4-formylpyrimidin-2-yl)piperazine-1-carboxylate
Modify Date: 2025-09-22 00:27:29
tert-butyl 4-(4-formylpyrimidin-2-yl)piperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-(4-formylpyrimidin-2-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 944901-19-3 | Molecular Weight | 292.33400 | |
| Density | 1.228g/cm3 | Boiling Point | 462.962ºC at 760 mmHg | |
| Molecular Formula | C14H20N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.792ºC | |
| Name | tert-butyl 4-(4-formylpyrimidin-2-yl)piperazine-1-carboxylate |
|---|
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 462.962ºC at 760 mmHg |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.33400 |
| Flash Point | 233.792ºC |
| Exact Mass | 292.15400 |
| PSA | 75.63000 |
| LogP | 1.34910 |
| Index of Refraction | 1.567 |
| InChIKey | GLHPFKFKWJZVQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nccc(C=O)n2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |