2-bromo-5-(6-chloropyridin-3-yl)pyridine structure
|
Common Name | 2-bromo-5-(6-chloropyridin-3-yl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 942206-04-4 | Molecular Weight | 269.52500 | |
| Density | 1.591g/cm3 | Boiling Point | 389.2ºC at 760 mmHg | |
| Molecular Formula | C10H6BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.2ºC | |
| Name | 2-bromo-5-(6-chloropyridin-3-yl)pyridine |
|---|
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 389.2ºC at 760 mmHg |
| Molecular Formula | C10H6BrClN2 |
| Molecular Weight | 269.52500 |
| Flash Point | 189.2ºC |
| Exact Mass | 267.94000 |
| PSA | 25.78000 |
| LogP | 3.55950 |
| Index of Refraction | 1.621 |
| InChIKey | VHZRDSCPWVOYIE-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2ccc(Br)nc2)cn1 |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |