2,2-dimethyl-4,6-dioxo-1-(2-phenylethyl)cyclohexane-1-carbonitrile structure
|
Common Name | 2,2-dimethyl-4,6-dioxo-1-(2-phenylethyl)cyclohexane-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 93031-13-1 | Molecular Weight | 269.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dimethyl-4,6-dioxo-1-(2-phenylethyl)cyclohexane-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19NO2 |
|---|---|
| Molecular Weight | 269.33800 |
| Exact Mass | 269.14200 |
| PSA | 57.93000 |
| LogP | 3.08738 |
| InChIKey | LODIYHUTKIYHNT-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CC(=O)C1(C#N)CCc1ccccc1 |
|
~19%
2,2-dimethyl-4,... CAS#:93031-13-1 |
| Literature: Banerjee, Satinath; Gupta, Mita Datta; Sarkar, Asis; Nasipuri, Dhanonjoy Journal of the Indian Chemical Society, 1983 , vol. 60, p. 1163 - 1168 |
| 4-cyano-5,5-dimethyl-4-phenethylcyclohex-1,3-dione |