1-(6-chloro-9H-carbazol-2-yl)ethanone structure
|
Common Name | 1-(6-chloro-9H-carbazol-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 92841-22-0 | Molecular Weight | 243.68800 | |
| Density | 1.357g/cm3 | Boiling Point | 453.1ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.8ºC | |
| Name | 1-(6-chloro-9H-carbazol-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 453.1ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.68800 |
| Flash Point | 227.8ºC |
| Exact Mass | 243.04500 |
| PSA | 32.86000 |
| LogP | 4.17710 |
| Index of Refraction | 1.725 |
| InChIKey | VCGYUAQMIROOQM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)[nH]c1ccc(Cl)cc12 |
| HS Code | 2933990090 |
|---|
|
~90%
1-(6-chloro-9H-... CAS#:92841-22-0 |
| Literature: Manchand, Percy S.; Coffen, David L.; Belica, Peter S.; Wong, Frederick; Wong, Harry S.; Berger, Leo Heterocycles, 1994 , vol. 39, # 2 p. 833 - 846 |
|
~%
1-(6-chloro-9H-... CAS#:92841-22-0 |
| Literature: Heterocycles, , vol. 39, # 2 p. 833 - 846 |
|
~%
1-(6-chloro-9H-... CAS#:92841-22-0 |
| Literature: Heterocycles, , vol. 39, # 2 p. 833 - 846 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-acetyl-6-chlorocarbazole |
| Ethanone,1-(6-chloro-9H-carbazol-2-yl) |
| Carprofen Impurity |
| UNII-K4QG935E2R |