methyl 6'-methoxy-1-methyl-3'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,2'-1H-indole]-4-carboxylate structure
|
Common Name | methyl 6'-methoxy-1-methyl-3'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,2'-1H-indole]-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 92471-49-3 | Molecular Weight | 398.45200 | |
| Density | 1.33g/cm3 | Boiling Point | 573.7ºC at 760 mmHg | |
| Molecular Formula | C22H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.8ºC | |
| Name | methyl 6'-methoxy-1-methyl-3'-oxospiro[1,4a,5,5a,7,8,10,10a-octahydropyrano[3,4-f]indolizine-6,2'-1H-indole]-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 573.7ºC at 760 mmHg |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.45200 |
| Flash Point | 300.8ºC |
| Exact Mass | 398.18400 |
| PSA | 77.10000 |
| LogP | 2.30410 |
| Index of Refraction | 1.625 |
| InChIKey | XBQWJIHJQVIDFT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCC4(Nc5cc(OC)ccc5C4=O)C3CC12 |
|
~%
methyl 6'-metho... CAS#:92471-49-3 |
| Literature: Finch,N. et al. Journal of the American Chemical Society, 1965 , vol. 87, # 10 p. 2229 - 2235 |
| Tetraphylline pseudoindoxyl |
| Tetraphylline pseudoindoxyl a |
| aricine pseudoindoxyl |
| Tetraphylline Pseudoindoxyle |
| Aricin-pseudoindoxyl |