2-(4-phenylphenyl)propanedinitrile structure
|
Common Name | 2-(4-phenylphenyl)propanedinitrile | ||
|---|---|---|---|---|
| CAS Number | 92427-54-8 | Molecular Weight | 218.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-phenylphenyl)propanedinitrile |
|---|
| Molecular Formula | C15H10N2 |
|---|---|
| Molecular Weight | 218.25300 |
| Exact Mass | 218.08400 |
| PSA | 47.58000 |
| LogP | 3.48436 |
| InChIKey | VGRMTZIIZROJRF-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)c1ccc(-c2ccccc2)cc1 |
|
~94%
2-(4-phenylphen... CAS#:92427-54-8 |
| Literature: Gao, Chengwei; Tao, Xiaochun; Qian, Yanlong; Huang, Jiling Chemical Communications, 2003 , # 12 p. 1444 - 1445 |
|
~84%
2-(4-phenylphen... CAS#:92427-54-8 |
| Literature: Uno, Mitsunari; Seto, Koji; Takahashi, Shigetoshi Journal of the Chemical Society, Chemical Communications, 1984 , # 14 p. 932 - 933 |