2,4-diamino-N-(3,4-dichlorophenyl)quinazoline-6-sulfonamide
Modify Date: 2025-09-27 16:44:35
2,4-diamino-N-(3,4-dichlorophenyl)quinazoline-6-sulfonamide structure
|
Common Name | 2,4-diamino-N-(3,4-dichlorophenyl)quinazoline-6-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 92144-28-0 | Molecular Weight | 384.24000 | |
| Density | 1.688g/cm3 | Boiling Point | 684.1ºC at 760 mmHg | |
| Molecular Formula | C14H11Cl2N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 367.6ºC | |
| Name | 2,4-diamino-N-(3,4-dichlorophenyl)quinazoline-6-sulfonamide |
|---|
| Density | 1.688g/cm3 |
|---|---|
| Boiling Point | 684.1ºC at 760 mmHg |
| Molecular Formula | C14H11Cl2N5O2S |
| Molecular Weight | 384.24000 |
| Flash Point | 367.6ºC |
| Exact Mass | 383.00100 |
| PSA | 133.83000 |
| LogP | 3.91580 |
| Index of Refraction | 1.763 |
| InChIKey | HHWIWTYLCSYMPN-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c2cc(S(=O)(=O)Nc3ccc(Cl)c(Cl)c3)ccc2n1 |
|
~%
2,4-diamino-N-(... CAS#:92144-28-0 |
| Literature: Elslager; Colbry; Davoll; Hutt; Johnson; Werbel Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1740 - 1743 |
|
~41%
2,4-diamino-N-(... CAS#:92144-28-0 |
| Literature: Elslager; Colbry; Davoll; Hutt; Johnson; Werbel Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1740 - 1743 |
