2-bromo-n-(4-hydroxyphenyl)benzamide structure
|
Common Name | 2-bromo-n-(4-hydroxyphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 92059-97-7 | Molecular Weight | 292.12800 | |
| Density | 1.597g/cm3 | Boiling Point | 360.4ºC at 760mmHg | |
| Molecular Formula | C13H10BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | 2-bromo-n-(4-hydroxyphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.597g/cm3 |
|---|---|
| Boiling Point | 360.4ºC at 760mmHg |
| Molecular Formula | C13H10BrNO2 |
| Molecular Weight | 292.12800 |
| Flash Point | 171.7ºC |
| Exact Mass | 290.98900 |
| PSA | 49.33000 |
| LogP | 3.48000 |
| Index of Refraction | 1.696 |
| InChIKey | ORCHLSBZTUMRNY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccccc1Br |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-Hydroxy-phenyl)-2-brom-benzamid |