Ethyl 2-(2-amino-2,3-dihydro-1H-inden-2-yl)acetate hydrochloride structure
|
Common Name | Ethyl 2-(2-amino-2,3-dihydro-1H-inden-2-yl)acetate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 917391-08-3 | Molecular Weight | 255.74100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-(2-amino-2,3-dihydro-1H-inden-2-yl)acetate hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18ClNO2 |
|---|---|
| Molecular Weight | 255.74100 |
| Exact Mass | 255.10300 |
| PSA | 52.32000 |
| LogP | 2.93820 |
| InChIKey | VHWRFNWGYKZUKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(N)Cc2ccccc2C1.Cl |
| HS Code | 2922499990 |
|---|
|
~99%
Ethyl 2-(2-amin... CAS#:917391-08-3 |
| Literature: ALTANA Pharma AG Patent: WO2006/134112 A1, 2006 ; Location in patent: Page/Page column 24 ; |
|
~99%
Ethyl 2-(2-amin... CAS#:917391-08-3 |
| Literature: ALTANA Pharma AG Patent: WO2006/134111 A1, 2006 ; Location in patent: Page/Page column 37 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Phosphinic acid,(2,6-dimethylphenyl)(diphenylmethyl)-,ethyl ester |
| ethyl (2,6-dimethylphenyl)(diphenylmethyl)phosphinate |
| ethyl (2-amino-2,3-dihydro-1H-inden-2-yl)acetate hydrochloride |