2-methyl-3-phenyl-N,N-dipropylpropanamide structure
|
Common Name | 2-methyl-3-phenyl-N,N-dipropylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 91424-86-1 | Molecular Weight | 247.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-phenyl-N,N-dipropylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H25NO |
|---|---|
| Molecular Weight | 247.37600 |
| Exact Mass | 247.19400 |
| PSA | 20.31000 |
| LogP | 3.51380 |
| InChIKey | VASFZSMQNZWOTE-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)C(C)Cc1ccccc1 |
|
~87%
2-methyl-3-phen... CAS#:91424-86-1 |
| Literature: Al-Jallo; Hussain; Mansoor; Sameh; Al-Saidi Journal of Chemical and Engineering Data, 1984 , vol. 29, # 4 p. 479 - 481 |
| n,n-dipropyl-2-methyl-3-phenylpropanamide |