5-phenyl-N,N-dipropylpentanamide structure
|
Common Name | 5-phenyl-N,N-dipropylpentanamide | ||
|---|---|---|---|---|
| CAS Number | 91424-79-2 | Molecular Weight | 261.40200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-N,N-dipropylpentanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H27NO |
|---|---|
| Molecular Weight | 261.40200 |
| Exact Mass | 261.20900 |
| PSA | 20.31000 |
| LogP | 4.04800 |
| InChIKey | UUNMEHGFECYUEJ-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)C(=O)CCCCc1ccccc1 |
|
~85%
5-phenyl-N,N-di... CAS#:91424-79-2 |
| Literature: Al-Jallo; Hussain; Mansoor; Sameh; Al-Saidi Journal of Chemical and Engineering Data, 1984 , vol. 29, # 4 p. 479 - 481 |
| N,N-DIPROPYL-5-PHENYLPENTANAMIDE |
| Benzenepentanamide,N,N-dipropyl |