[2-(2,4-dimethoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester
Modify Date: 2025-08-26 13:34:12
![[2-(2,4-dimethoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester Structure](https://image.chemsrc.com/caspic/353/912762-41-5.png)
[2-(2,4-dimethoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester structure
|
Common Name | [2-(2,4-dimethoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 912762-41-5 | Molecular Weight | 295.33100 | |
| Density | 1.119g/cm3 | Boiling Point | 454.8ºC at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
| Name | [2-(2,4-dimethoxy-phenyl)-2-oxo-ethyl]-carbamic acid tert-butyl ester |
|---|
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 454.8ºC at 760 mmHg |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33100 |
| Flash Point | 228.8ºC |
| Exact Mass | 295.14200 |
| PSA | 73.86000 |
| LogP | 2.80210 |
| Index of Refraction | 1.504 |
| InChIKey | CORPLXUZVOQZQZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CNC(=O)OC(C)(C)C)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |