2-chloro-4-methylsulfanyl-6-phenylpyridine-3-carbonitrile structure
|
Common Name | 2-chloro-4-methylsulfanyl-6-phenylpyridine-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 91272-04-7 | Molecular Weight | 260.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-4-methylsulfanyl-6-phenylpyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9ClN2S |
|---|---|
| Molecular Weight | 260.74200 |
| Exact Mass | 260.01700 |
| PSA | 61.98000 |
| LogP | 3.99558 |
| InChIKey | LHYLFUNWNYUKHB-UHFFFAOYSA-N |
| SMILES | CSc1cc(-c2ccccc2)nc(Cl)c1C#N |
|
~81%
2-chloro-4-meth... CAS#:91272-04-7 |
| Literature: Peseke, K.; Michalik, M.; Schoenhusen, U.; Quincoces, J.; Radeglia, R. Journal fuer Praktische Chemie (Leipzig), 1987 , vol. 329, # 5 p. 877 - 884 |
|
~61%
2-chloro-4-meth... CAS#:91272-04-7 |
| Literature: Saxena, Abhishek S.; Goel, Atul; Ram, Vishnu Ji Journal of the Indian Chemical Society, 2003 , vol. 80, # 4 p. 311 - 318 |
| 3-Pyridinecarbonitrile,2-chloro-4-(methylthio)-6-phenyl |
| 2-Chlor-4-methylthio-6-phenyl-nicotinonitril |
| 2-chloro-3-cyano-6-phenyl-4-methylthiopyridine |