5-cyclohexyl-2-methoxy-1,3-dinitrobenzene structure
|
Common Name | 5-cyclohexyl-2-methoxy-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 91069-24-8 | Molecular Weight | 280.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-cyclohexyl-2-methoxy-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16N2O5 |
|---|---|
| Molecular Weight | 280.27700 |
| Exact Mass | 280.10600 |
| PSA | 100.87000 |
| LogP | 4.60570 |
| InChIKey | MGVJKTBKUGZFQF-UHFFFAOYSA-N |
| SMILES | COc1c([N+](=O)[O-])cc(C2CCCCC2)cc1[N+](=O)[O-] |
|
~%
5-cyclohexyl-2-... CAS#:91069-24-8 |
| Literature: Bartlett; Garland Journal of the American Chemical Society, 1933 , vol. 55, p. 2064,2066 |
| 4-cyclohexyl-2,6-dinitro-anisole |
| 4-Cyclohexyl-2,6-dinitro-anisol |
| Benzene,5-cyclohexyl-2-methoxy-1,3-dinitro |
| Methyl-(2.6-dinitro-4-cyclohexyl-phenyl)-aether |
| 3.5-Dinitro-4-methoxy-1-cyclohexyl-benzol |