N-methyl-1-(3-nitrophenyl)methanamine,chloride structure
|
Common Name | N-methyl-1-(3-nitrophenyl)methanamine,chloride | ||
|---|---|---|---|---|
| CAS Number | 90389-70-1 | Molecular Weight | 201.63000 | |
| Density | 1.162g/cm3 | Boiling Point | 274.3ºC at 760mmHg | |
| Molecular Formula | C8H10ClN2O2- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.7ºC | |
| Name | N-methyl-1-(3-nitrophenyl)methanamine,chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 274.3ºC at 760mmHg |
| Molecular Formula | C8H10ClN2O2- |
| Molecular Weight | 201.63000 |
| Flash Point | 119.7ºC |
| Exact Mass | 201.04300 |
| PSA | 57.85000 |
| InChIKey | PBYAYJHCOPZPDI-UHFFFAOYSA-N |
| SMILES | CNCc1cccc([N+](=O)[O-])c1.Cl |
|
~%
N-methyl-1-(3-n... CAS#:90389-70-1 |
| Literature: Connolly, Terrence J.; Constantinescu, Anton; Lane, Tim S.; Matchett, Michael; McGarry, Patrick; Paperna, Mariya Organic Process Research and Development, 2005 , vol. 9, # 6 p. 837 - 842 |
|
~%
N-methyl-1-(3-n... CAS#:90389-70-1 |
| Literature: Connolly, Terrence J.; Constantinescu, Anton; Lane, Tim S.; Matchett, Michael; McGarry, Patrick; Paperna, Mariya Organic Process Research and Development, 2005 , vol. 9, # 6 p. 837 - 842 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-methyl-3-nitro-benzenemethanamine,monohydrochloride |
| N-methyl-3-nitro-N-phenyl-2-pyridinamine |
| 2-N-Methylanilino-3-nitropyridin |
| 2-Pyridinamine,N-methyl-3-nitro-N-phenyl |