2-(4-chloro-3-nitrophenoxy)acetic acid structure
|
Common Name | 2-(4-chloro-3-nitrophenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 89894-13-3 | Molecular Weight | 231.59000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chloro-3-nitrophenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6ClNO5 |
|---|---|
| Molecular Weight | 231.59000 |
| Exact Mass | 230.99300 |
| PSA | 92.35000 |
| LogP | 2.23480 |
| InChIKey | NNDWXLRSQALFKC-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1ccc(Cl)c([N+](=O)[O-])c1 |
|
~%
2-(4-chloro-3-n... CAS#:89894-13-3 |
| Literature: Hayes; Branch Journal of the American Chemical Society, 1943 , vol. 65, p. 1555 |
| 4-Chlor-3-nitro-phenoxyessigsaeure |