1-chloro-10-hydroxy-8-methylphenoxaphosphinine 10-oxide structure
|
Common Name | 1-chloro-10-hydroxy-8-methylphenoxaphosphinine 10-oxide | ||
|---|---|---|---|---|
| CAS Number | 89869-19-2 | Molecular Weight | 280.64300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-10-hydroxy-8-methylphenoxaphosphinine 10-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10ClO3P |
|---|---|
| Molecular Weight | 280.64300 |
| Exact Mass | 280.00600 |
| PSA | 56.34000 |
| LogP | 2.97530 |
| InChIKey | RNJHTYXHJOLUTR-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)P(=O)(O)c1c(Cl)cccc1O2 |
|
~8%
1-chloro-10-hyd... CAS#:89869-19-2 |
| Literature: Renger, B. Phosphorus and Sulfur and the Related Elements, 1988 , vol. 35, p. 215 - 218 |
| 1-Chlor-8-methyl-10-hydroxy-10H-phenoxaphosphin-10-oxid |
| 1-chloro-8-methyl-10-hydroxy-10H-phenoxaphosphine-10-oxide |
| 10H-Phenoxaphosphine,1-chloro-10-hydroxy-8-methyl-,10-oxide |