6-chloro-2,4-dimethyl-3-nitropyridine structure
|
Common Name | 6-chloro-2,4-dimethyl-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 89793-08-8 | Molecular Weight | 186.59600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-2,4-dimethyl-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7ClN2O2 |
|---|---|
| Molecular Weight | 186.59600 |
| Exact Mass | 186.02000 |
| PSA | 58.71000 |
| LogP | 2.78320 |
| InChIKey | MZJLDJKORNDTNV-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)nc(C)c1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~%
6-chloro-2,4-di... CAS#:89793-08-8 |
| Literature: Mariella et al. Journal of Organic Chemistry, 1955 , vol. 20, p. 1721,1727 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chlor-2,4-dimethyl-3-nitro-pyridin |
| 6-Chlor-3-nitro-2,4-dimethyl-pyridin |
| 6-chloro-2,4-dimethyl-3-nitro-pyridine |