2-Iodo-5-methoxy-1,3-dinitrobenzene structure
|
Common Name | 2-Iodo-5-methoxy-1,3-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 89677-78-1 | Molecular Weight | 324.02900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5IN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Iodo-5-methoxy-1,3-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5IN2O5 |
|---|---|
| Molecular Weight | 324.02900 |
| Exact Mass | 323.92400 |
| PSA | 100.87000 |
| LogP | 3.16260 |
| InChIKey | PKBGJAOYYBZPBH-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(I)c([N+](=O)[O-])c1 |
|
~%
2-Iodo-5-methox... CAS#:89677-78-1 |
| Literature: Meldola; Hay Journal of the Chemical Society, 1907 , vol. 91, p. 1481 Journal of the Chemical Society, 1909 , vol. 95, p. 1380 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-iodanyl-5-methoxy-1,3-dinitro-benzene |
| Benzene,2-iodo-5-methoxy-1,3-dinitro |
| 3,5-dinitro-4-iodoanisole |
| 4-Jod-3,5-dinitro-anisol |
| Anisole,4-iodo-3,5-dinitro-(7CI) |
| 4-iodo-3,5-dinitro-anisole |
| Methyl-(4-jod-3.5-dinitro-phenyl)-aether |