2,3-diamino-6-phenyl-1,2,4-triazin-5-one structure
|
Common Name | 2,3-diamino-6-phenyl-1,2,4-triazin-5-one | ||
|---|---|---|---|---|
| CAS Number | 89569-68-6 | Molecular Weight | 203.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-diamino-6-phenyl-1,2,4-triazin-5-one |
|---|
| Molecular Formula | C9H9N5O |
|---|---|
| Molecular Weight | 203.20100 |
| Exact Mass | 203.08100 |
| PSA | 100.55000 |
| LogP | 0.11260 |
| InChIKey | BDHIIDZTCZIZLB-UHFFFAOYSA-N |
| SMILES | Nc1nc(=O)c(-c2ccccc2)nn1N |
|
~78%
2,3-diamino-6-p... CAS#:89569-68-6 |
| Literature: Sanemitsu, Yuzuru; Nakayama, Yoshinori; Shiroshita, Masao Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1671 - 1675 |
|
~%
2,3-diamino-6-p... CAS#:89569-68-6 |
| Literature: Sanemitsu, Yuzuru; Nakayama, Yoshinori; Shiroshita, Masao Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1671 - 1675 |