3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one structure
|
Common Name | 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one | ||
|---|---|---|---|---|
| CAS Number | 89569-53-9 | Molecular Weight | 370.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(2-methoxyphenyl)-(2-phenylhydrazinyl)methylidene]quinoxalin-2-one |
|---|
| Molecular Formula | C22H18N4O2 |
|---|---|
| Molecular Weight | 370.40400 |
| Exact Mass | 370.14300 |
| PSA | 75.08000 |
| LogP | 1.79520 |
| InChIKey | VTFKDRUWBMVMNX-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=NNc1ccccc1)c1nc2ccccc2[nH]c1=O |
|
~%
3-[(2-methoxyph... CAS#:89569-53-9 |
| Literature: Vinot, Nicole; Bellec, Christian; Maitte, Pierre Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1645 - 1650 |
|
~%
3-[(2-methoxyph... CAS#:89569-53-9 |
| Literature: Vinot, Nicole; Bellec, Christian; Maitte, Pierre Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1645 - 1650 |