2-diphenylphosphoryl-3-methyl-1-phenylbutan-1-one structure
|
Common Name | 2-diphenylphosphoryl-3-methyl-1-phenylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 89091-86-1 | Molecular Weight | 362.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-diphenylphosphoryl-3-methyl-1-phenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H23O2P |
|---|---|
| Molecular Weight | 362.40100 |
| Exact Mass | 362.14400 |
| PSA | 43.95000 |
| LogP | 4.90800 |
| InChIKey | RLKULRHZMZNVKC-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
|
~68%
2-diphenylphosp... CAS#:89091-86-1 |
| Literature: Buss, Antony D.; Mason, Ralph; Warren, Stuart Tetrahedron Letters, 1983 , vol. 24, # 47 p. 5293 - 5296 |
|
~%
2-diphenylphosp... CAS#:89091-86-1 |
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2307 - 2326 |
|
~%
2-diphenylphosp... CAS#:89091-86-1 |
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 2307 - 2326 |
| 2-diphenylphosphinoyl-3-methyl-1-phenylbutan-1-one |
| 1-Butanone,2-(diphenylphosphinyl)-3-methyl-1-phenyl |