6-(2-morpholin-4-ylethyl)azepane-2,5-dione structure
|
Common Name | 6-(2-morpholin-4-ylethyl)azepane-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 89003-67-8 | Molecular Weight | 240.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-morpholin-4-ylethyl)azepane-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20N2O3 |
|---|---|
| Molecular Weight | 240.29900 |
| Exact Mass | 240.14700 |
| PSA | 62.13000 |
| LogP | 0.01780 |
| InChIKey | YQHQJEAMAXDCII-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=O)C(CCN2CCOCC2)CN1 |
|
~25%
6-(2-morpholin-... CAS#:89003-67-8 |
| Literature: Coyle, John D.; Bryant, Laurence, R. B. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2857 - 2865 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-<2-(morpholin-4-yl)ethyl>perhydroazepine-2,5-dione |
| 1H-Azepine-2,5-dione,tetrahydro-6-[2-(4-morpholinyl)ethyl] |