4-[[4-(dipropylamino)phenyl]methyl]-N,N-dipropylaniline
Modify Date: 2025-08-25 00:26:22
![4-[[4-(dipropylamino)phenyl]methyl]-N,N-dipropylaniline Structure](https://image.chemsrc.com/caspic/025/88990-60-7.png)
4-[[4-(dipropylamino)phenyl]methyl]-N,N-dipropylaniline structure
|
Common Name | 4-[[4-(dipropylamino)phenyl]methyl]-N,N-dipropylaniline | ||
|---|---|---|---|---|
| CAS Number | 88990-60-7 | Molecular Weight | 366.58300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H38N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[4-(dipropylamino)phenyl]methyl]-N,N-dipropylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H38N2 |
|---|---|
| Molecular Weight | 366.58300 |
| Exact Mass | 366.30300 |
| PSA | 6.48000 |
| LogP | 6.53020 |
| InChIKey | ZPTROIWJRZKUIU-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)c1ccc(Cc2ccc(N(CCC)CCC)cc2)cc1 |
|
~%
4-[[4-(dipropyl... CAS#:88990-60-7 |
| Literature: Reid; Lynch Journal of the American Chemical Society, 1936 , vol. 58, p. 1430 |
|
~%
4-[[4-(dipropyl... CAS#:88990-60-7 |
| Literature: Nayar, Mazhuvadyil R. Gopinathan; Francis, Joseph D. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 776 - 780 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bis-(4-dipropylamino-phenyl)-methan |
| Benzenamine,4,4'-methylenebis[N,N-dipropyl |
| bis-(4-dipropylamino-phenyl)-methane |
| bis<N,N-di(n-propyl)aminophenyl>methane |