1,1,2,2,3,3-hexakis(2,2-dimethylpropyl)trisilirane structure
|
Common Name | 1,1,2,2,3,3-hexakis(2,2-dimethylpropyl)trisilirane | ||
|---|---|---|---|---|
| CAS Number | 88652-70-4 | Molecular Weight | 511.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H66Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2,3,3-hexakis(2,2-dimethylpropyl)trisilirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H66Si3 |
|---|---|
| Molecular Weight | 511.10200 |
| Exact Mass | 510.44700 |
| LogP | 10.85820 |
| InChIKey | IGHXLHFHKMUOQV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C[Si]1(CC(C)(C)C)[Si](CC(C)(C)C)(CC(C)(C)C)[Si]1(CC(C)(C)C)CC(C)(C)C |
|
~14%
1,1,2,2,3,3-hex... CAS#:88652-70-4 |
| Literature: Watanabe, Hamao; Okawa, Tadashi; Kato, Motohiko; Nagai, Yoichiro Journal of the Chemical Society, Chemical Communications, 1983 , # 13 p. 781 - 782 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Cyclotrisilane,hexakis(2,2-dimethylpropyl) |
| hexaneopentylcyclotrisilane |