5,7-dimethoxy-8-nitro-2-phenylchromen-4-one structure
|
Common Name | 5,7-dimethoxy-8-nitro-2-phenylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 88503-22-4 | Molecular Weight | 327.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,7-dimethoxy-8-nitro-2-phenylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13NO6 |
|---|---|
| Molecular Weight | 327.28800 |
| Exact Mass | 327.07400 |
| PSA | 94.49000 |
| LogP | 3.90860 |
| InChIKey | WNBAMAKRYQZOGX-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccccc3)oc2c1[N+](=O)[O-] |
|
~79%
5,7-dimethoxy-8... CAS#:88503-22-4 |
| Literature: Larget, Ronan; Lockhart, Brian; Renard, Pierre; Largeron, Martine Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 8 p. 835 - 838 |
|
~83%
5,7-dimethoxy-8... CAS#:88503-22-4 |
| Literature: Gao, Hong; Kawabata, Jun Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 5 p. 1661 - 1671 |
|
~%
5,7-dimethoxy-8... CAS#:88503-22-4 |
| Literature: Larget, Ronan; Lockhart, Brian; Renard, Pierre; Largeron, Martine Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 8 p. 835 - 838 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 5,7-dimethoxy-8-nitroflavone |
| 4H-1-Benzopyran-4-one,5,7-dimethoxy-8-nitro-2-phenyl |