6-chloro-3-nitrophenanthridine structure
|
Common Name | 6-chloro-3-nitrophenanthridine | ||
|---|---|---|---|---|
| CAS Number | 88418-52-4 | Molecular Weight | 258.66000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-3-nitrophenanthridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H7ClN2O2 |
|---|---|
| Molecular Weight | 258.66000 |
| Exact Mass | 258.02000 |
| PSA | 58.71000 |
| LogP | 4.47280 |
| InChIKey | ZTPQDVNVPYZCFO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)nc(Cl)c1ccccc12 |
|
~%
6-chloro-3-nitr... CAS#:88418-52-4 |
| Literature: Nunn et al. Journal of the Chemical Society, 1952 , p. 2797,2801 |
| 6-chloro-3-nitro-phenanthridine |
| 6-Chlor-3-nitro-phenanthridin |
| 3-nitro-6-chlorophenanthridine |
| Phenanthridine,6-chloro-3-nitro |