methyl 2-bromo-3,6-dimethoxy-5-methylbenzoate structure
|
Common Name | methyl 2-bromo-3,6-dimethoxy-5-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 88208-69-9 | Molecular Weight | 289.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-bromo-3,6-dimethoxy-5-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13BrO4 |
|---|---|
| Molecular Weight | 289.12300 |
| Exact Mass | 288.00000 |
| PSA | 44.76000 |
| LogP | 2.56130 |
| InChIKey | SYOKASWZTJVIKY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(Br)c(OC)cc(C)c1OC |
|
~%
methyl 2-bromo-... CAS#:88208-69-9 |
| Literature: Giles, Robin G. F.; Mitchell, Peter R. K.; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2147 - 2152 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,2-bromo-3,6-dimethoxy-5-methyl-,methyl ester |
| methyl 6-bromo-2,5-dimethoxy-3-methylbenzoate |