8-amino-5-methylbenzo[b]carbazole-6,11-dione structure
|
Common Name | 8-amino-5-methylbenzo[b]carbazole-6,11-dione | ||
|---|---|---|---|---|
| CAS Number | 88207-17-4 | Molecular Weight | 276.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-amino-5-methylbenzo[b]carbazole-6,11-dione |
|---|
| Molecular Formula | C17H12N2O2 |
|---|---|
| Molecular Weight | 276.28900 |
| Exact Mass | 276.09000 |
| PSA | 65.09000 |
| LogP | 3.11710 |
| InChIKey | OXRRSLBVSDDVOZ-UHFFFAOYSA-N |
| SMILES | Cn1c2c(c3ccccc31)C(=O)c1ccc(N)cc1C2=O |
|
~%
8-amino-5-methy... CAS#:88207-17-4 |
| Literature: Ashcroft, William R.; Dalton, Lesley; Beal, Michael G.; Humphrey, Godfred L.; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2409 - 2412 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |