5-bromo-1,4,6-triphenylpyrimidin-2-one structure
|
Common Name | 5-bromo-1,4,6-triphenylpyrimidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 88039-41-2 | Molecular Weight | 403.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H15BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-1,4,6-triphenylpyrimidin-2-one |
|---|
| Molecular Formula | C22H15BrN2O |
|---|---|
| Molecular Weight | 403.27100 |
| Exact Mass | 402.03700 |
| PSA | 34.89000 |
| LogP | 5.32900 |
| InChIKey | DIWGWYXBUHGZTI-UHFFFAOYSA-N |
| SMILES | O=c1nc(-c2ccccc2)c(Br)c(-c2ccccc2)n1-c1ccccc1 |
|
~%
5-bromo-1,4,6-t... CAS#:88039-41-2 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
|
~%
5-bromo-1,4,6-t... CAS#:88039-41-2 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |