4-[4-chloro-2-(2-chlorobenzoyl)phenyl]pyrimidine-5-carbonitrile structure
|
Common Name | 4-[4-chloro-2-(2-chlorobenzoyl)phenyl]pyrimidine-5-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 87999-64-2 | Molecular Weight | 354.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H9Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-chloro-2-(2-chlorobenzoyl)phenyl]pyrimidine-5-carbonitrile |
|---|
| Molecular Formula | C18H9Cl2N3O |
|---|---|
| Molecular Weight | 354.19000 |
| Exact Mass | 353.01200 |
| PSA | 66.64000 |
| LogP | 4.55308 |
| InChIKey | YBQMTDPMIUQOBJ-UHFFFAOYSA-N |
| SMILES | N#Cc1cncnc1-c1ccc(Cl)cc1C(=O)c1ccccc1Cl |
|
~8%
4-[4-chloro-2-(... CAS#:87999-64-2 |
| Literature: Coffen; Schaer; Bizzarro; Cheung Journal of Organic Chemistry, 1984 , vol. 49, # 2 p. 296 - 300 |
|
~%
4-[4-chloro-2-(... CAS#:87999-64-2 |
| Literature: Coffen; Schaer; Bizzarro; Cheung Journal of Organic Chemistry, 1984 , vol. 49, # 2 p. 296 - 300 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |