3-propan-2-ylidenespiro[5.5]undeca-1,4-diene structure
|
Common Name | 3-propan-2-ylidenespiro[5.5]undeca-1,4-diene | ||
|---|---|---|---|---|
| CAS Number | 87482-35-7 | Molecular Weight | 188.30900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-propan-2-ylidenespiro[5.5]undeca-1,4-diene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20 |
|---|---|
| Molecular Weight | 188.30900 |
| Exact Mass | 188.15700 |
| LogP | 4.39930 |
| InChIKey | ANVNCVKZVRJIBU-UHFFFAOYSA-N |
| SMILES | CC(C)=C1C=CC2(C=C1)CCCCC2 |
|
~24%
3-propan-2-ylid... CAS#:87482-35-7 |
| Literature: Murray, Diane F. Journal of Organic Chemistry, 1983 , vol. 48, # 25 p. 4860 - 4864 |
|
~%
3-propan-2-ylid... CAS#:87482-35-7 |
| Literature: Murray, Diane F. Journal of Organic Chemistry, 1983 , vol. 48, # 25 p. 4860 - 4864 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Spiro[5.5]undeca-1,4-diene,3-(1-methylethylidene) |
| 3-isopropylidenespiro<5.5>undeca-1,4-diene |