2-(carboxylatomethylsulfanyl)acetate,tris(2-hydroxyethyl)azanium structure
|
Common Name | 2-(carboxylatomethylsulfanyl)acetate,tris(2-hydroxyethyl)azanium | ||
|---|---|---|---|---|
| CAS Number | 87298-95-1 | Molecular Weight | 448.52900 | |
| Density | N/A | Boiling Point | 335.4ºC at 760 mmHg | |
| Molecular Formula | C16H36N2O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185ºC | |
| Name | 2-(carboxylatomethylsulfanyl)acetate,tris(2-hydroxyethyl)azanium |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 335.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H36N2O10S |
| Molecular Weight | 448.52900 |
| Flash Point | 185ºC |
| Exact Mass | 448.20900 |
| PSA | 227.76000 |
| InChIKey | NWGABUNPARSMIM-UHFFFAOYSA-N |
| SMILES | O=C([O-])CSCC(=O)[O-].OCC[NH+](CCO)CCO.OCC[NH+](CCO)CCO |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Thiodiacetic acid triethanolamine |
| 2-(2-oxido-2-oxoethyl)sulfanylacetate |
| bis[2-hydroxy-N,N-bis(2-hydroxyethyl)ethanaminium] 2,2'-sulfanediyldiacetate |
| Bis<tris-(2-hydroxyethyl)>ammonium salt of thiodiglycolic acid |
| tris(2-hydroxyethyl)azanium |
| ACETIC ACID,THIODI-,compd. with 2,2',2''-NITRILOTRIS(ETHANOL) (1:2) |
| (Carboxymethylthio)acetic acid bis[tris-(2-hydroxyethyl)ammonium]salt |
| Thiodiacetic acid 2,2',2''-nitrilotriethanol salt (1:2) |