bicyclo[4.1.0]heptane-1,6-dicarboxylic acid structure
|
Common Name | bicyclo[4.1.0]heptane-1,6-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 85739-45-3 | Molecular Weight | 184.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bicyclo[4.1.0]heptane-1,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H12O4 |
|---|---|
| Molecular Weight | 184.18900 |
| Exact Mass | 184.07400 |
| PSA | 74.60000 |
| LogP | 1.10610 |
| InChIKey | ZMEFMXQCMSTETF-UHFFFAOYSA-N |
| SMILES | O=C(O)C12CCCCC1(C(=O)O)C2 |
|
~68%
bicyclo[4.1.0]h... CAS#:85739-45-3 |
| Literature: Wiberg, Kenneth B.; Artis, Dean R.; Bonneville Journal of the American Chemical Society, 1991 , vol. 113, # 21 p. 7969 - 7979 |
|
~%
bicyclo[4.1.0]h... CAS#:85739-45-3 |
| Literature: Kenneth, B. Wiberg; Bonneville, George Tetrahedron Letters, 1982 , vol. 23, # 51 p. 5385 - 5388 |
| bicyclo<4.1.0>heptane-1,6-dicarboxylic acid |