5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide structure
|
Common Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 85619-27-8 | Molecular Weight | 289.33100 | |
| Density | 1.348g/cm3 | Boiling Point | 639.6ºC at 760 mmHg | |
| Molecular Formula | C18H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,11-dimethyl-6H-pyrido[4,3-b]carbazole-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 639.6ºC at 760 mmHg |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.33100 |
| Exact Mass | 289.12200 |
| PSA | 71.77000 |
| LogP | 4.28530 |
| Index of Refraction | 1.79 |
| InChIKey | LXKIIMAUMJSHGL-UHFFFAOYSA-N |
| SMILES | Cc1c2ccnc(C(N)=O)c2c(C)c2c1[nH]c1ccccc12 |
|
~93%
5,11-dimethyl-6... CAS#:85619-27-8 |
| Literature: Popp; Veeraraghaven Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 6 p. 1275 - 1280 |
|
~%
5,11-dimethyl-6... CAS#:85619-27-8 |
| Literature: Popp; Veeraraghaven Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 6 p. 1275 - 1280 |
|
~%
5,11-dimethyl-6... CAS#:85619-27-8 |
| Literature: Popp; Veeraraghaven Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 6 p. 1275 - 1280 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Relert |
| ELETRIPTAN HBR |
| Eletriptan hydrobromide |
| ellipticine-1-carboxamide |
| Eletriptan Base |