4-[(1,3-dioxo-1,3-diphenylpropan-2-yl)diazenyl]benzoic acid
Modify Date: 2025-09-22 11:57:07
![4-[(1,3-dioxo-1,3-diphenylpropan-2-yl)diazenyl]benzoic acid Structure](https://image.chemsrc.com/caspic/302/84037-31-0.png)
4-[(1,3-dioxo-1,3-diphenylpropan-2-yl)diazenyl]benzoic acid structure
|
Common Name | 4-[(1,3-dioxo-1,3-diphenylpropan-2-yl)diazenyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 84037-31-0 | Molecular Weight | 372.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(1,3-dioxo-1,3-diphenylpropan-2-yl)diazenyl]benzoic acid |
|---|
| Molecular Formula | C22H16N2O4 |
|---|---|
| Molecular Weight | 372.37300 |
| Exact Mass | 372.11100 |
| PSA | 96.16000 |
| LogP | 4.60290 |
| InChIKey | VBSFIOUNBIJNEE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N=NC(C(=O)c2ccccc2)C(=O)c2ccccc2)cc1 |
|
~%
4-[(1,3-dioxo-1... CAS#:84037-31-0 |
| Literature: Amir; Alam, Shah; Drabu, Khan S. Journal of the Indian Chemical Society, 2002 , vol. 79, # 3 p. 280 - 281 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |