N',N'-dimethyl-N-[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]ethane-1,2-diamine structure
|
Common Name | N',N'-dimethyl-N-[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]ethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 83726-81-2 | Molecular Weight | 249.33500 | |
| Density | 1.246g/cm3 | Boiling Point | 427.6ºC at 760 mmHg | |
| Molecular Formula | C11H15N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | N',N'-dimethyl-N-[4-(1,3-thiazol-2-yl)pyrimidin-2-yl]ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 427.6ºC at 760 mmHg |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.33500 |
| Flash Point | 212.4ºC |
| Exact Mass | 249.10500 |
| PSA | 82.18000 |
| LogP | 1.64660 |
| Index of Refraction | 1.624 |
| InChIKey | OGULKBKBRJVWDZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCNc1nccc(-c2nccs2)n1 |
|
~%
N',N'-dimethyl-... CAS#:83726-81-2 |
| Literature: Brown; Cowden; Strekowski Australian Journal of Chemistry, 1982 , vol. 35, # 6 p. 1209 - 1214 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Thiazol-2-NHEtNMe2-Pyrimidine |