4-tert-butyl-1,2-bis(3-chloropropoxy)benzene structure
|
Common Name | 4-tert-butyl-1,2-bis(3-chloropropoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 83557-02-2 | Molecular Weight | 319.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-1,2-bis(3-chloropropoxy)benzene |
|---|
| Molecular Formula | C16H24Cl2O2 |
|---|---|
| Molecular Weight | 319.26700 |
| Exact Mass | 318.11500 |
| PSA | 18.46000 |
| LogP | 4.99950 |
| InChIKey | MIJKJBVOGVHEAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OCCCCl)c(OCCCCl)c1 |
|
~76%
4-tert-butyl-1,... CAS#:83557-02-2 |
| Literature: Hiratani; Taguchi; Sugihara; Iio Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 7 p. 1976 - 1984 |
|
~%
4-tert-butyl-1,... CAS#:83557-02-2 |
| Literature: Hiratani; Taguchi; Sugihara; Iio Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 7 p. 1976 - 1984 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |