4-ethyl-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-5-oxo-2H-pyrrole-1-carboxamide,5-[[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione,hydrochloride structure
|
Common Name | 4-ethyl-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-5-oxo-2H-pyrrole-1-carboxamide,5-[[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 834894-07-4 | Molecular Weight | 883.51500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H55ClN6O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethyl-3-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-5-oxo-2H-pyrrole-1-carboxamide,5-[[4-[2-(5-ethylpyridin-2-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C43H55ClN6O8S2 |
|---|---|
| Molecular Weight | 883.51500 |
| Exact Mass | 882.32100 |
| PSA | 237.12000 |
| LogP | 9.12990 |
| InChIKey | RWJPQBWTYNIUEF-UHFFFAOYSA-N |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC3CCC(C)CC3)cc2)C1=O.CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1.Cl |
| Glimepiride mixture with Pioglitazone hydrochloride |
| Tandemact |
| Glimepiride mixture with pioglitazone |
| Glimepiride mixture with Pioglitazone HCl |
| Pioglitazone hydrochloride and glimepiride |