N-(5-aminopyridin-2-yl)-2,2-dimethylpropanamide structure
|
Common Name | N-(5-aminopyridin-2-yl)-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 827585-99-9 | Molecular Weight | 193.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(5-aminopyridin-2-yl)-2,2-dimethylpropanamide |
|---|
| Molecular Formula | C10H15N3O |
|---|---|
| Molecular Weight | 193.24600 |
| Exact Mass | 193.12200 |
| PSA | 71.50000 |
| LogP | 2.87910 |
| InChIKey | FNALDGVGTOAKGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1ccc(N)cn1 |
|
~%
N-(5-aminopyrid... CAS#:827585-99-9 |
| Literature: MERCK SHARP and DOHME CORP.; WOOD, Harold, B.; ADAMS, Alan, D.; SZEWCZYK, Jason, W.; ZHANG, Yong; YANG, Meng Patent: WO2011/19538 A1, 2011 ; Location in patent: Page/Page column 141 ; WO 2011/019538 A1 |
|
~%
N-(5-aminopyrid... CAS#:827585-99-9 |
| Literature: MERCK SHARP and DOHME CORP.; WOOD, Harold, B.; ADAMS, Alan, D.; SZEWCZYK, Jason, W.; ZHANG, Yong; YANG, Meng Patent: WO2011/19538 A1, 2011 ; WO 2011/019538 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |