3-[6-(phenylmethoxyamino)purin-9-yl]propanenitrile structure
|
Common Name | 3-[6-(phenylmethoxyamino)purin-9-yl]propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 827584-80-5 | Molecular Weight | 294.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[6-(phenylmethoxyamino)purin-9-yl]propanenitrile |
|---|
| Molecular Formula | C15H14N6O |
|---|---|
| Molecular Weight | 294.31100 |
| Exact Mass | 294.12300 |
| PSA | 88.65000 |
| LogP | 2.35668 |
| InChIKey | SYULCPPYJWVWTL-UHFFFAOYSA-N |
| SMILES | N#CCCn1cnc2c(NOCc3ccccc3)ncnc21 |
|
~77%
3-[6-(phenylmet... CAS#:827584-80-5 |
| Literature: Pappo, Doron; Shimony, Shiri; Kashman, Yoel Journal of Organic Chemistry, 2005 , vol. 70, # 1 p. 199 - 206 |
|
~%
3-[6-(phenylmet... CAS#:827584-80-5 |
| Literature: Pappo, Doron; Shimony, Shiri; Kashman, Yoel Journal of Organic Chemistry, 2005 , vol. 70, # 1 p. 199 - 206 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |