tributyl-[3-(2-phenylethynyl)hept-1-en-2-yl]stannane
Modify Date: 2025-08-25 21:54:56
![tributyl-[3-(2-phenylethynyl)hept-1-en-2-yl]stannane Structure](https://image.chemsrc.com/caspic/066/820250-73-5.png)
tributyl-[3-(2-phenylethynyl)hept-1-en-2-yl]stannane structure
|
Common Name | tributyl-[3-(2-phenylethynyl)hept-1-en-2-yl]stannane | ||
|---|---|---|---|---|
| CAS Number | 820250-73-5 | Molecular Weight | 487.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H44Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-[3-(2-phenylethynyl)hept-1-en-2-yl]stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H44Sn |
|---|---|
| Molecular Weight | 487.33900 |
| Exact Mass | 488.24600 |
| LogP | 8.31470 |
| InChIKey | JBWRAOFCHOGPQZ-UHFFFAOYSA-N |
| SMILES | C=C(C(C#Cc1ccccc1)CCCC)[Sn](CCCC)(CCCC)CCCC |
|
~%
tributyl-[3-(2-... CAS#:820250-73-5 |
| Literature: Shirakawa, Eiji; Hiyama, Tamejiro Bulletin of the Chemical Society of Japan, 2002 , vol. 75, # 7 p. 1435 - 1450 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-butyl-5-phenyl-2-tributylstannyl-1-penten-4-yne |
| Stannane,tributyl[1-methylene-2-(phenylethynyl)hexyl] |