O-Desacetyl-N-desmethyl Diltiazem structure
|
Common Name | O-Desacetyl-N-desmethyl Diltiazem | ||
|---|---|---|---|---|
| CAS Number | 81353-09-5 | Molecular Weight | 358.45500 | |
| Density | 1.239g/cm3 | Boiling Point | 612ºC at 760 mmHg | |
| Molecular Formula | C19H22N2O3S | Melting Point | 134-136ºC (dec.) | |
| MSDS | N/A | Flash Point | 323.9ºC | |
| Name | O-Desacetyl-N-desmethyl Diltiazem |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 612ºC at 760 mmHg |
| Melting Point | 134-136ºC (dec.) |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.45500 |
| Flash Point | 323.9ºC |
| Exact Mass | 358.13500 |
| PSA | 87.10000 |
| LogP | 2.91140 |
| Index of Refraction | 1.612 |
| InChIKey | HNXJRKQNTGIDDU-UHFFFAOYSA-N |
| SMILES | CNCCN1C(=O)C(O)C(c2ccc(OC)cc2)Sc2ccccc21 |
|
~%
O-Desacetyl-N-d... CAS#:81353-09-5 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 26, # 9 p. 2889 - 2893 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Deacetyl N-Monodesmethyl Diltiazem |
| 3-Hydroxy-2-(4-methoxy-phenyl)-5-(2-methylamino-ethyl)-2,3-dihydro-5H-benzo[b][1,4]thiazepin-4-one |
| 3c-hydroxy-2r-(4-methoxy-phenyl)-5-(2-methylamino-ethyl)-2,3-dihydro-5H-benzo[b][1,4]thiazepin-4-one |
| Diltiazem Impurity 7 |