2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione,2-(trichloromethylsulfanyl)isoindole-1,3-dione
Modify Date: 2025-08-20 12:07:51
2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione,2-(trichloromethylsulfanyl)isoindole-1,3-dione structure
|
Common Name | 2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione,2-(trichloromethylsulfanyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 8066-46-4 | Molecular Weight | 645.61900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13Cl7N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,1,2,2-tetrachloroethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione,2-(trichloromethylsulfanyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13Cl7N2O4S2 |
|---|---|
| Molecular Weight | 645.61900 |
| Exact Mass | 641.81400 |
| PSA | 125.36000 |
| LogP | 6.65520 |
| InChIKey | LFCFRTJAHYBZPU-UHFFFAOYSA-N |
| SMILES | O=C1C2CC=CCC2C(=O)N1SC(Cl)(Cl)C(Cl)Cl.O=C1c2ccccc2C(=O)N1SC(Cl)(Cl)Cl |
| 3a,4,7,7a-Tetrahydro-2-((1,1,2,2-tetrachloroethyl)thio)-1H-isoindole-1,3(2H)-dione mixt. with 2-((trichloromethyl)thio)-1H-isoindole-1,3(2H)-dione |
| Captafol-folpet mixt. |
| 1H-Isoindole-1,3(2H)-dione,3a,4,7,7a-tetrahydro-2-((1,1,2,2-tetrachloroethyl)thio)-,mixt. with 2-((trichloromethyl)thio)-1H-isoindole-1,3(2H)-dione |
| Folpet-captafol |