5-ethyl-5-methyl-N-phenyl-1,3,4-thiadiazol-2-imine structure
|
Common Name | 5-ethyl-5-methyl-N-phenyl-1,3,4-thiadiazol-2-imine | ||
|---|---|---|---|---|
| CAS Number | 80269-70-1 | Molecular Weight | 219.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-5-methyl-N-phenyl-1,3,4-thiadiazol-2-imine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13N3S |
|---|---|
| Molecular Weight | 219.30600 |
| Exact Mass | 219.08300 |
| PSA | 62.38000 |
| LogP | 2.87050 |
| InChIKey | VXFYAXVSAOARQL-UHFFFAOYSA-N |
| SMILES | CCC1(C)N=NC(=Nc2ccccc2)S1 |
|
~83%
5-ethyl-5-methy... CAS#:80269-70-1 |
| Literature: Yamamoto, Iwao; Abe, Ikuo; Nozawa, Muneharu; Kotani, Mitsuhiro; Motoyoshiya, Jiro; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2297 - 2301 |
| 2-ethyl-2-methyl-5-phenylimino-2,5-dihydro-1,3,4-thiadiazole |
| Benzenamine,N-(5-ethyl-5-methyl-1,3,4-thiadiazol-2(5H)-ylidene) |
| 5-Ethyl-2,5-dihydro-5-methyl-2-(phenylimino)-1,3,4-thiadiazole |