5-methoxy-2-methyl-3-propylnaphthalene-1,4-dione structure
|
Common Name | 5-methoxy-2-methyl-3-propylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 80213-78-1 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-2-methyl-3-propylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 43.37000 |
| LogP | 3.19080 |
| InChIKey | WNTVOXRIDGLFGO-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C)C(=O)c2cccc(OC)c2C1=O |
|
~%
5-methoxy-2-met... CAS#:80213-78-1 |
| Literature: Wulff, William D.; Tang, Peng-Cho; McCallum, J. Stuart Journal of the American Chemical Society, 1981 , vol. 103, # 25 p. 7677 - 7678 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-Naphthalenedione,5-methoxy-2-methyl-3-propyl |