6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine,4-N-(3-methoxypropyl)-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine
Modify Date: 2025-09-07 16:16:56
6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine,4-N-(3-methoxypropyl)-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine structure
|
Common Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine,4-N-(3-methoxypropyl)-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 8000-52-0 | Molecular Weight | 473.03900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H33ClN10OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine,4-N-(3-methoxypropyl)-6-methylsulfanyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H33ClN10OS |
|---|---|
| Molecular Weight | 473.03900 |
| Exact Mass | 472.22500 |
| PSA | 172.91000 |
| LogP | 0.93840 |
| InChIKey | RHGLURZJQLTNBD-UHFFFAOYSA-N |
| SMILES | CCNc1nc(Cl)nc(NCC)n1.COCCCNc1nc(NC(C)C)nc(SC)n1 |
| 6-Chloro-N,N'-diethyl-1,3,5-triazine-2,4-diamine mixt. with N-(3-methoxypropyl)-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
| Methoprotryn-simazine mixt. |
| 1,3,5-Triazine-2,4-diamine,6-chloro-N,N'-diethyl-,mixt. with N-(3-methoxypropyl)-N'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine |
| Gesaran 211 |
| Simazine-methoprotryn mixt. |
| Gesaran 207 |
| Avetit |
| Gesaran 2079 |