N-(3,5-dichloro-4-hydroxyphenyl)acetamide structure
|
Common Name | N-(3,5-dichloro-4-hydroxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 79694-26-1 | Molecular Weight | 220.05300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3,5-dichloro-4-hydroxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7Cl2NO2 |
|---|---|
| Molecular Weight | 220.05300 |
| Exact Mass | 218.98500 |
| PSA | 52.82000 |
| LogP | 3.30690 |
| InChIKey | METFEORCOGUCCZ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(Cl)c(O)c(Cl)c1 |
|
~%
N-(3,5-dichloro... CAS#:79694-26-1 |
| Literature: Duffy; Dearden; Rostron Journal of Pharmacy and Pharmacology, 2001 , vol. 53, # 11 p. 1505 - 1514 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-acetamido-2,6-dichlorophenol |
| Acetamide,N-(3,5-dichloro-4-hydroxyphenyl) |